C16H20FNO2 — CID 114460177
2-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-3-fluorobenzoic acid (PubChem CID 114460177) has the molecular formula C16H20FNO2 and a molecular weight of 277.34 g/mol. Its IUPAC name is 2-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-3-fluorobenzoic acid.
| Compound Name | 2-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 114460177 |
| Molecular Formula | C16H20FNO2 |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 2-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-3-fluorobenzoic acid |
| SMILES | CC(C)(C)C1=CCN(c2c(F)cccc2C(=O)O)CC1 |
| InChI | InChI=1S/C16H20FNO2/c1-16(2,3)11-7-9-18(10-8-11)14-12(15(19)20)5-4-6-13(14)17/h4-7H,8-10H2,1-3H3,(H,19,20) |
| InChIKey | JPMSWNOGZUFWIV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|