C15H19ClN2O2 — CID 107063092
2-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-3-chloropyridine-4-carboxylic acid (PubChem CID 107063092) has the molecular formula C15H19ClN2O2 and a molecular weight of 294.78 g/mol. Its IUPAC name is 2-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-3-chloropyridine-4-carboxylic acid.
| Compound Name | 2-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-3-chloropyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 107063092 |
| Molecular Formula | C15H19ClN2O2 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 2-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-3-chloropyridine-4-carboxylic acid |
| SMILES | CC(C)(C)C1=CCN(c2nccc(C(=O)O)c2Cl)CC1 |
| InChI | InChI=1S/C15H19ClN2O2/c1-15(2,3)10-5-8-18(9-6-10)13-12(16)11(14(19)20)4-7-17-13/h4-5,7H,6,8-9H2,1-3H3,(H,19,20) |
| InChIKey | USMIBAIQJRDVCJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|