C13H18FN3O — CID 102813334
1-[4-[3-(aminomethyl)-5-fluorophenyl]piperazin-1-yl]ethanone (PubChem CID 102813334) has the molecular formula C13H18FN3O and a molecular weight of 251.30 g/mol. Its IUPAC name is 1-[4-[3-(aminomethyl)-5-fluorophenyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[3-(aminomethyl)-5-fluorophenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 102813334 |
| Molecular Formula | C13H18FN3O |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 1-[4-[3-(aminomethyl)-5-fluorophenyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2cc(F)cc(CN)c2)CC1 |
| InChI | InChI=1S/C13H18FN3O/c1-10(18)16-2-4-17(5-3-16)13-7-11(9-15)6-12(14)8-13/h6-8H,2-5,9,15H2,1H3 |
| InChIKey | FXJZMLQVMCTETG-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |