C13H17F3N4 — CID 114489491
[5,6-dimethyl-3-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]pyridazin-4-yl]methanamine (PubChem CID 114489491) has the molecular formula C13H17F3N4 and a molecular weight of 286.30 g/mol. Its IUPAC name is [5,6-dimethyl-3-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]pyridazin-4-yl]methanamine.
| Compound Name | [5,6-dimethyl-3-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]pyridazin-4-yl]methanamine |
|---|---|
| PubChem CID | 114489491 |
| Molecular Formula | C13H17F3N4 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | [5,6-dimethyl-3-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]pyridazin-4-yl]methanamine |
| SMILES | Cc1nnc(N2CC=C(C(F)(F)F)CC2)c(CN)c1C |
| InChI | InChI=1S/C13H17F3N4/c1-8-9(2)18-19-12(11(8)7-17)20-5-3-10(4-6-20)13(14,15)16/h3H,4-7,17H2,1-2H3 |
| InChIKey | AENVTNLXBGIIDI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|