C15H18F3NO2 — CID 104930367
(1S)-1-[2-methoxy-6-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]phenyl]ethanol (PubChem CID 104930367) has the molecular formula C15H18F3NO2 and a molecular weight of 301.31 g/mol. Its IUPAC name is (1S)-1-[2-methoxy-6-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]phenyl]ethanol.
| Compound Name | (1S)-1-[2-methoxy-6-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]phenyl]ethanol |
|---|---|
| PubChem CID | 104930367 |
| Molecular Formula | C15H18F3NO2 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | (1S)-1-[2-methoxy-6-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]phenyl]ethanol |
| SMILES | COc1cccc(N2CC=C(C(F)(F)F)CC2)c1[C@H](C)O |
| InChI | InChI=1S/C15H18F3NO2/c1-10(20)14-12(4-3-5-13(14)21-2)19-8-6-11(7-9-19)15(16,17)18/h3-6,10,20H,7-9H2,1-2H3/t10-/m0/s1 |
| InChIKey | FBHUPAQQTRPENN-JTQLQIEISA-N |
| XLogP | 3.45 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|