C14H15F4NO — CID 114490352
1-[3-fluoro-4-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]phenyl]ethanol (PubChem CID 114490352) has the molecular formula C14H15F4NO and a molecular weight of 289.27 g/mol. Its IUPAC name is 1-[3-fluoro-4-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]phenyl]ethanol.
| Compound Name | 1-[3-fluoro-4-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]phenyl]ethanol |
|---|---|
| PubChem CID | 114490352 |
| Molecular Formula | C14H15F4NO |
| Molecular Weight | 289.27 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 1-[3-fluoro-4-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]phenyl]ethanol |
| SMILES | CC(O)c1ccc(N2CC=C(C(F)(F)F)CC2)c(F)c1 |
| InChI | InChI=1S/C14H15F4NO/c1-9(20)10-2-3-13(12(15)8-10)19-6-4-11(5-7-19)14(16,17)18/h2-4,8-9,20H,5-7H2,1H3 |
| InChIKey | LUYLZGAKLWNXRK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.27 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|