C13H14BrF3N2 — CID 114900813
[4-bromo-2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]phenyl]methanamine (PubChem CID 114900813) has the molecular formula C13H14BrF3N2 and a molecular weight of 335.17 g/mol. Its IUPAC name is [4-bromo-2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]phenyl]methanamine.
| Compound Name | [4-bromo-2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]phenyl]methanamine |
|---|---|
| PubChem CID | 114900813 |
| Molecular Formula | C13H14BrF3N2 |
| Molecular Weight | 335.17 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | [4-bromo-2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]phenyl]methanamine |
| SMILES | NCc1ccc(Br)cc1N1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H14BrF3N2/c14-11-2-1-9(8-18)12(7-11)19-5-3-10(4-6-19)13(15,16)17/h1-3,7H,4-6,8,18H2 |
| InChIKey | YHXSFDMAUQNKHF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.17 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|