C14H13BrF3NO — CID 114490048
1-[5-bromo-2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]phenyl]ethanone (PubChem CID 114490048) has the molecular formula C14H13BrF3NO and a molecular weight of 348.16 g/mol. Its IUPAC name is 1-[5-bromo-2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]phenyl]ethanone.
| Compound Name | 1-[5-bromo-2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 114490048 |
| Molecular Formula | C14H13BrF3NO |
| Molecular Weight | 348.16 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | 1-[5-bromo-2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]phenyl]ethanone |
| SMILES | CC(=O)c1cc(Br)ccc1N1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H13BrF3NO/c1-9(20)12-8-11(15)2-3-13(12)19-6-4-10(5-7-19)14(16,17)18/h2-4,8H,5-7H2,1H3 |
| InChIKey | VUCNHBMTZRVLLF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.16 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|