C13H14BrNO2 — CID 114896035
5-bromo-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)benzoic acid (PubChem CID 114896035) has the molecular formula C13H14BrNO2 and a molecular weight of 296.16 g/mol. Its IUPAC name is 5-bromo-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)benzoic acid.
| Compound Name | 5-bromo-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 114896035 |
| Molecular Formula | C13H14BrNO2 |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 5-bromo-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)benzoic acid |
| SMILES | CC1=CCN(c2ccc(Br)cc2C(=O)O)CC1 |
| InChI | InChI=1S/C13H14BrNO2/c1-9-4-6-15(7-5-9)12-3-2-10(14)8-11(12)13(16)17/h2-4,8H,5-7H2,1H3,(H,16,17) |
| InChIKey | JYXLVYGHADEEPH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|