C14H19BrN2 — CID 114410367
1-[3-bromo-4-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)phenyl]ethanamine (PubChem CID 114410367) has the molecular formula C14H19BrN2 and a molecular weight of 295.22 g/mol. Its IUPAC name is 1-[3-bromo-4-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)phenyl]ethanamine.
| Compound Name | 1-[3-bromo-4-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 114410367 |
| Molecular Formula | C14H19BrN2 |
| Molecular Weight | 295.22 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 1-[3-bromo-4-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)phenyl]ethanamine |
| SMILES | CC1=CCN(c2ccc(C(C)N)cc2Br)CC1 |
| InChI | InChI=1S/C14H19BrN2/c1-10-5-7-17(8-6-10)14-4-3-12(11(2)16)9-13(14)15/h3-5,9,11H,6-8,16H2,1-2H3 |
| InChIKey | IOXNGNPFQVZUJQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.22 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|