C15H24BrN3 — CID 104937425
(1S)-1-[3-bromo-4-(3,4,5-trimethylpiperazin-1-yl)phenyl]ethanamine (PubChem CID 104937425) has the molecular formula C15H24BrN3 and a molecular weight of 326.28 g/mol. Its IUPAC name is (1S)-1-[3-bromo-4-(3,4,5-trimethylpiperazin-1-yl)phenyl]ethanamine.
| Compound Name | (1S)-1-[3-bromo-4-(3,4,5-trimethylpiperazin-1-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 104937425 |
| Molecular Formula | C15H24BrN3 |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | (1S)-1-[3-bromo-4-(3,4,5-trimethylpiperazin-1-yl)phenyl]ethanamine |
| SMILES | CC1CN(c2ccc([C@H](C)N)cc2Br)CC(C)N1C |
| InChI | InChI=1S/C15H24BrN3/c1-10-8-19(9-11(2)18(10)4)15-6-5-13(12(3)17)7-14(15)16/h5-7,10-12H,8-9,17H2,1-4H3/t10?,11?,12-/m0/s1 |
| InChIKey | SBFLUFLJUIOXNG-MCIGGMRASA-N |
| XLogP | 3.00 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |