C14H22BrN3 — CID 114087057
1-[3-bromo-4-(2,4-dimethylpiperazin-1-yl)phenyl]ethanamine (PubChem CID 114087057) has the molecular formula C14H22BrN3 and a molecular weight of 312.26 g/mol. Its IUPAC name is 1-[3-bromo-4-(2,4-dimethylpiperazin-1-yl)phenyl]ethanamine.
| Compound Name | 1-[3-bromo-4-(2,4-dimethylpiperazin-1-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 114087057 |
| Molecular Formula | C14H22BrN3 |
| Molecular Weight | 312.26 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 1-[3-bromo-4-(2,4-dimethylpiperazin-1-yl)phenyl]ethanamine |
| SMILES | CC(N)c1ccc(N2CCN(C)CC2C)c(Br)c1 |
| InChI | InChI=1S/C14H22BrN3/c1-10-9-17(3)6-7-18(10)14-5-4-12(11(2)16)8-13(14)15/h4-5,8,10-11H,6-7,9,16H2,1-3H3 |
| InChIKey | CHOBZOKZOSIINZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |