C14H17F3N2 — CID 114489683
[2-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]phenyl]methanamine (PubChem CID 114489683) has the molecular formula C14H17F3N2 and a molecular weight of 270.30 g/mol. Its IUPAC name is [2-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]phenyl]methanamine.
| Compound Name | [2-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]phenyl]methanamine |
|---|---|
| PubChem CID | 114489683 |
| Molecular Formula | C14H17F3N2 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | [2-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]phenyl]methanamine |
| SMILES | NCc1ccccc1CN1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H17F3N2/c15-14(16,17)13-5-7-19(8-6-13)10-12-4-2-1-3-11(12)9-18/h1-5H,6-10,18H2 |
| InChIKey | PLZBSDYQUGEOTJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|