C13H18N2O — CID 104921402
(1S)-1-[2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-4-pyridinyl]ethanol (PubChem CID 104921402) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is (1S)-1-[2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-4-pyridinyl]ethanol.
| Compound Name | (1S)-1-[2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-4-pyridinyl]ethanol |
|---|---|
| PubChem CID | 104921402 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | (1S)-1-[2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-4-pyridinyl]ethanol |
| SMILES | CC1=CCN(c2cc([C@H](C)O)ccn2)CC1 |
| InChI | InChI=1S/C13H18N2O/c1-10-4-7-15(8-5-10)13-9-12(11(2)16)3-6-14-13/h3-4,6,9,11,16H,5,7-8H2,1-2H3/t11-/m0/s1 |
| InChIKey | IGUKQHBSHMBEPT-NSHDSACASA-N |
| XLogP | 2.29 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|