C14H22N2O2 — CID 114218551
1-[2-(2-ethyl-1,4-oxazepan-4-yl)-4-pyridinyl]ethanol (PubChem CID 114218551) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-[2-(2-ethyl-1,4-oxazepan-4-yl)-4-pyridinyl]ethanol.
| Compound Name | 1-[2-(2-ethyl-1,4-oxazepan-4-yl)-4-pyridinyl]ethanol |
|---|---|
| PubChem CID | 114218551 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 1-[2-(2-ethyl-1,4-oxazepan-4-yl)-4-pyridinyl]ethanol |
| SMILES | CCC1CN(c2cc(C(C)O)ccn2)CCCO1 |
| InChI | InChI=1S/C14H22N2O2/c1-3-13-10-16(7-4-8-18-13)14-9-12(11(2)17)5-6-15-14/h5-6,9,11,13,17H,3-4,7-8,10H2,1-2H3 |
| InChIKey | ZJZDNUSVJHEUFX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |