C12H15NO — CID 130617448
(1S)-1-[4-(2,5-dihydropyrrol-1-yl)phenyl]ethanol (PubChem CID 130617448) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is (1S)-1-[4-(2,5-dihydropyrrol-1-yl)phenyl]ethanol.
| Compound Name | (1S)-1-[4-(2,5-dihydropyrrol-1-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 130617448 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | (1S)-1-[4-(2,5-dihydropyrrol-1-yl)phenyl]ethanol |
| SMILES | C[C@H](O)c1ccc(N2CC=CC2)cc1 |
| InChI | InChI=1S/C12H15NO/c1-10(14)11-4-6-12(7-5-11)13-8-2-3-9-13/h2-7,10,14H,8-9H2,1H3/t10-/m0/s1 |
| InChIKey | CVJQZQHYPDGXAM-JTQLQIEISA-N |
| XLogP | 2.12 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|