C15H21NO — CID 115560514
(1R)-1-[4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)phenyl]ethanol (PubChem CID 115560514) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is (1R)-1-[4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)phenyl]ethanol.
| Compound Name | (1R)-1-[4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 115560514 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | (1R)-1-[4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)phenyl]ethanol |
| SMILES | C[C@@H](O)c1ccc(N2CC3CCCC3C2)cc1 |
| InChI | InChI=1S/C15H21NO/c1-11(17)12-5-7-15(8-6-12)16-9-13-3-2-4-14(13)10-16/h5-8,11,13-14,17H,2-4,9-10H2,1H3/t11-,13?,14?/m1/s1 |
| InChIKey | DLKUDCUKQHZMII-LMWSTFAQSA-N |
| XLogP | 2.98 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|