C17H25NO — CID 102727152
(1R)-1-[4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]phenyl]ethanol (PubChem CID 102727152) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is (1R)-1-[4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]phenyl]ethanol.
| Compound Name | (1R)-1-[4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]phenyl]ethanol |
|---|---|
| PubChem CID | 102727152 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | (1R)-1-[4-[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]phenyl]ethanol |
| SMILES | C[C@@H](O)c1ccc(N2CCC[C@H]3CCCC[C@H]32)cc1 |
| InChI | InChI=1S/C17H25NO/c1-13(19)14-8-10-16(11-9-14)18-12-4-6-15-5-2-3-7-17(15)18/h8-11,13,15,17,19H,2-7,12H2,1H3/t13-,15-,17-/m1/s1 |
| InChIKey | UCDMAXCKCTUTJV-FRFSOERESA-N |
| XLogP | 3.90 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|