C16H24N2O — CID 83132541
1-[5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-pyridinyl]ethanol (PubChem CID 83132541) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 1-[5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-pyridinyl]ethanol.
| Compound Name | 1-[5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-pyridinyl]ethanol |
|---|---|
| PubChem CID | 83132541 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 1-[5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-pyridinyl]ethanol |
| SMILES | CC(O)c1ccc(N2CCCC3CCCCC32)cn1 |
| InChI | InChI=1S/C16H24N2O/c1-12(19)15-9-8-14(11-17-15)18-10-4-6-13-5-2-3-7-16(13)18/h8-9,11-13,16,19H,2-7,10H2,1H3 |
| InChIKey | VEZWIFCZNFSYPU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |