C16H25N3 — CID 103937555
(1S)-1-[5-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-pyridinyl]propan-1-amine (PubChem CID 103937555) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is (1S)-1-[5-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-pyridinyl]propan-1-amine.
| Compound Name | (1S)-1-[5-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-pyridinyl]propan-1-amine |
|---|---|
| PubChem CID | 103937555 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | (1S)-1-[5-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-2-pyridinyl]propan-1-amine |
| SMILES | CC[C@H](N)c1ccc(N2CCC3CCCCC32)cn1 |
| InChI | InChI=1S/C16H25N3/c1-2-14(17)15-8-7-13(11-18-15)19-10-9-12-5-3-4-6-16(12)19/h7-8,11-12,14,16H,2-6,9-10,17H2,1H3/t12?,14-,16?/m0/s1 |
| InChIKey | URCJLELWXFAVIT-UGWHAMFMSA-N |
| XLogP | 3.26 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |