C15H23NO — CID 78940969
(1R)-1-[4-(2,3-dimethylpiperidin-1-yl)phenyl]ethanol (PubChem CID 78940969) has the molecular formula C15H23NO and a molecular weight of 233.36 g/mol. Its IUPAC name is (1R)-1-[4-(2,3-dimethylpiperidin-1-yl)phenyl]ethanol.
| Compound Name | (1R)-1-[4-(2,3-dimethylpiperidin-1-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 78940969 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | (1R)-1-[4-(2,3-dimethylpiperidin-1-yl)phenyl]ethanol |
| SMILES | CC1CCCN(c2ccc([C@@H](C)O)cc2)C1C |
| InChI | InChI=1S/C15H23NO/c1-11-5-4-10-16(12(11)2)15-8-6-14(7-9-15)13(3)17/h6-9,11-13,17H,4-5,10H2,1-3H3/t11?,12?,13-/m1/s1 |
| InChIKey | NJPDENCTPCMQCH-WXRRBKDZSA-N |
| XLogP | 3.36 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|