C17H26N2O — CID 81199057
(1R)-1-[4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)phenyl]ethanol (PubChem CID 81199057) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is (1R)-1-[4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)phenyl]ethanol.
| Compound Name | (1R)-1-[4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 81199057 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | (1R)-1-[4-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)phenyl]ethanol |
| SMILES | C[C@@H](O)c1ccc(N2CCC3C(CCCN3C)C2)cc1 |
| InChI | InChI=1S/C17H26N2O/c1-13(20)14-5-7-16(8-6-14)19-11-9-17-15(12-19)4-3-10-18(17)2/h5-8,13,15,17,20H,3-4,9-12H2,1-2H3/t13-,15?,17?/m1/s1 |
| InChIKey | AWPDUXGPTOOSAF-BZOOQXSSSA-N |
| XLogP | 2.66 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|