C14H21NO2 — CID 103942840
1-[1-[4-[(1S)-1-hydroxyethyl]phenyl]pyrrolidin-3-yl]ethanol (PubChem CID 103942840) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 1-[1-[4-[(1S)-1-hydroxyethyl]phenyl]pyrrolidin-3-yl]ethanol.
| Compound Name | 1-[1-[4-[(1S)-1-hydroxyethyl]phenyl]pyrrolidin-3-yl]ethanol |
|---|---|
| PubChem CID | 103942840 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 1-[1-[4-[(1S)-1-hydroxyethyl]phenyl]pyrrolidin-3-yl]ethanol |
| SMILES | CC(O)C1CCN(c2ccc([C@H](C)O)cc2)C1 |
| InChI | InChI=1S/C14H21NO2/c1-10(16)12-3-5-14(6-4-12)15-8-7-13(9-15)11(2)17/h3-6,10-11,13,16-17H,7-9H2,1-2H3/t10-,11?,13?/m0/s1 |
| InChIKey | YRGCQVGJEVYZFH-ZBOXLXRLSA-N |
| XLogP | 1.95 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|