C13H19NO2 — CID 78941068
(1R)-1-[4-(1,4-oxazepan-4-yl)phenyl]ethanol (PubChem CID 78941068) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is (1R)-1-[4-(1,4-oxazepan-4-yl)phenyl]ethanol.
| Compound Name | (1R)-1-[4-(1,4-oxazepan-4-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 78941068 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (1R)-1-[4-(1,4-oxazepan-4-yl)phenyl]ethanol |
| SMILES | C[C@@H](O)c1ccc(N2CCCOCC2)cc1 |
| InChI | InChI=1S/C13H19NO2/c1-11(15)12-3-5-13(6-4-12)14-7-2-9-16-10-8-14/h3-6,11,15H,2,7-10H2,1H3/t11-/m1/s1 |
| InChIKey | HDBKEECTIARQET-LLVKDONJSA-N |
| XLogP | 1.97 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|