C13H18FNO2 — CID 78941064
(1R)-1-[3-fluoro-4-(1,4-oxazepan-4-yl)phenyl]ethanol (PubChem CID 78941064) has the molecular formula C13H18FNO2 and a molecular weight of 239.29 g/mol. Its IUPAC name is (1R)-1-[3-fluoro-4-(1,4-oxazepan-4-yl)phenyl]ethanol.
| Compound Name | (1R)-1-[3-fluoro-4-(1,4-oxazepan-4-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 78941064 |
| Molecular Formula | C13H18FNO2 |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | (1R)-1-[3-fluoro-4-(1,4-oxazepan-4-yl)phenyl]ethanol |
| SMILES | C[C@@H](O)c1ccc(N2CCCOCC2)c(F)c1 |
| InChI | InChI=1S/C13H18FNO2/c1-10(16)11-3-4-13(12(14)9-11)15-5-2-7-17-8-6-15/h3-4,9-10,16H,2,5-8H2,1H3/t10-/m1/s1 |
| InChIKey | QUXJEOTZFQJPNL-SNVBAGLBSA-N |
| XLogP | 2.11 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|