C10H18F3N3O2S — CID 114491119
N-(3-aminopropyl)-N-methyl-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine-1-sulfonamide (PubChem CID 114491119) has the molecular formula C10H18F3N3O2S and a molecular weight of 301.33 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-methyl-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine-1-sulfonamide.
| Compound Name | N-(3-aminopropyl)-N-methyl-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine-1-sulfonamide |
|---|---|
| PubChem CID | 114491119 |
| Molecular Formula | C10H18F3N3O2S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | N-(3-aminopropyl)-N-methyl-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine-1-sulfonamide |
| SMILES | CN(CCCN)S(=O)(=O)N1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H18F3N3O2S/c1-15(6-2-5-14)19(17,18)16-7-3-9(4-8-16)10(11,12)13/h3H,2,4-8,14H2,1H3 |
| InChIKey | AGKJBWFVKOHXGG-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|