C9H19N3O2S — CID 114414187
N-(3-aminopropyl)-N-methyl-3,6-dihydro-2H-pyridine-1-sulfonamide (PubChem CID 114414187) has the molecular formula C9H19N3O2S and a molecular weight of 233.34 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-methyl-3,6-dihydro-2H-pyridine-1-sulfonamide.
| Compound Name | N-(3-aminopropyl)-N-methyl-3,6-dihydro-2H-pyridine-1-sulfonamide |
|---|---|
| PubChem CID | 114414187 |
| Molecular Formula | C9H19N3O2S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | N-(3-aminopropyl)-N-methyl-3,6-dihydro-2H-pyridine-1-sulfonamide |
| SMILES | CN(CCCN)S(=O)(=O)N1CC=CCC1 |
| InChI | InChI=1S/C9H19N3O2S/c1-11(7-5-6-10)15(13,14)12-8-3-2-4-9-12/h2-3H,4-10H2,1H3 |
| InChIKey | VYJXKZXVGBUHHV-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|