C12H12F3NO2S — CID 115770434
1-(benzenesulfonyl)-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine (PubChem CID 115770434) has the molecular formula C12H12F3NO2S and a molecular weight of 291.29 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine.
| Compound Name | 1-(benzenesulfonyl)-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 115770434 |
| Molecular Formula | C12H12F3NO2S |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 1-(benzenesulfonyl)-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine |
| SMILES | O=S(=O)(c1ccccc1)N1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H12F3NO2S/c13-12(14,15)10-6-8-16(9-7-10)19(17,18)11-4-2-1-3-5-11/h1-6H,7-9H2 |
| InChIKey | HBXYWYPJILDYMV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|