C12H13F3N2O3S — CID 114489353
2-amino-4-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]phenol (PubChem CID 114489353) has the molecular formula C12H13F3N2O3S and a molecular weight of 322.31 g/mol. Its IUPAC name is 2-amino-4-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]phenol.
| Compound Name | 2-amino-4-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]phenol |
|---|---|
| PubChem CID | 114489353 |
| Molecular Formula | C12H13F3N2O3S |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 2-amino-4-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]phenol |
| SMILES | Nc1cc(S(=O)(=O)N2CC=C(C(F)(F)F)CC2)ccc1O |
| InChI | InChI=1S/C12H13F3N2O3S/c13-12(14,15)8-3-5-17(6-4-8)21(19,20)9-1-2-11(18)10(16)7-9/h1-3,7,18H,4-6,16H2 |
| InChIKey | LRHDFTWIRUNGHW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|