C12H18N2O5S — CID 103530304
2-amino-4-(3,4-dimethoxypyrrolidin-1-yl)sulfonylphenol (PubChem CID 103530304) has the molecular formula C12H18N2O5S and a molecular weight of 302.35 g/mol. Its IUPAC name is 2-amino-4-(3,4-dimethoxypyrrolidin-1-yl)sulfonylphenol.
| Compound Name | 2-amino-4-(3,4-dimethoxypyrrolidin-1-yl)sulfonylphenol |
|---|---|
| PubChem CID | 103530304 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2-amino-4-(3,4-dimethoxypyrrolidin-1-yl)sulfonylphenol |
| SMILES | COC1CN(S(=O)(=O)c2ccc(O)c(N)c2)CC1OC |
| InChI | InChI=1S/C12H18N2O5S/c1-18-11-6-14(7-12(11)19-2)20(16,17)8-3-4-10(15)9(13)5-8/h3-5,11-12,15H,6-7,13H2,1-2H3 |
| InChIKey | LLIQVIBDPBUHTF-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|