C13H21N3O3S — CID 43585652
2-amino-4-[4-(dimethylamino)piperidin-1-yl]sulfonylphenol (PubChem CID 43585652) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is 2-amino-4-[4-(dimethylamino)piperidin-1-yl]sulfonylphenol.
| Compound Name | 2-amino-4-[4-(dimethylamino)piperidin-1-yl]sulfonylphenol |
|---|---|
| PubChem CID | 43585652 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-amino-4-[4-(dimethylamino)piperidin-1-yl]sulfonylphenol |
| SMILES | CN(C)C1CCN(S(=O)(=O)c2ccc(O)c(N)c2)CC1 |
| InChI | InChI=1S/C13H21N3O3S/c1-15(2)10-5-7-16(8-6-10)20(18,19)11-3-4-13(17)12(14)9-11/h3-4,9-10,17H,5-8,14H2,1-2H3 |
| InChIKey | UOOKVMSNRQOXHF-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|