C12H19N3O4S — CID 103530617
3-amino-4-(3,4-dimethoxypyrrolidin-1-yl)benzenesulfonamide (PubChem CID 103530617) has the molecular formula C12H19N3O4S and a molecular weight of 301.37 g/mol. Its IUPAC name is 3-amino-4-(3,4-dimethoxypyrrolidin-1-yl)benzenesulfonamide.
| Compound Name | 3-amino-4-(3,4-dimethoxypyrrolidin-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 103530617 |
| Molecular Formula | C12H19N3O4S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 3-amino-4-(3,4-dimethoxypyrrolidin-1-yl)benzenesulfonamide |
| SMILES | COC1CN(c2ccc(S(N)(=O)=O)cc2N)CC1OC |
| InChI | InChI=1S/C12H19N3O4S/c1-18-11-6-15(7-12(11)19-2)10-4-3-8(5-9(10)13)20(14,16)17/h3-5,11-12H,6-7,13H2,1-2H3,(H2,14,16,17) |
| InChIKey | HHBFLNOAKJAITE-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|