C10H15N3O4S2 — CID 43581395
3-amino-4-(1,1-dioxo-1,4-thiazinan-4-yl)benzenesulfonamide (PubChem CID 43581395) has the molecular formula C10H15N3O4S2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 3-amino-4-(1,1-dioxo-1,4-thiazinan-4-yl)benzenesulfonamide.
| Compound Name | 3-amino-4-(1,1-dioxo-1,4-thiazinan-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 43581395 |
| Molecular Formula | C10H15N3O4S2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 3-amino-4-(1,1-dioxo-1,4-thiazinan-4-yl)benzenesulfonamide |
| SMILES | Nc1cc(S(N)(=O)=O)ccc1N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H15N3O4S2/c11-9-7-8(19(12,16)17)1-2-10(9)13-3-5-18(14,15)6-4-13/h1-2,7H,3-6,11H2,(H2,12,16,17) |
| InChIKey | OCTQCBXINPLYKO-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 123.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|