C11H16N2O3S2 — CID 54975253
5-methylsulfonyl-2-(1-oxo-1,4-thiazinan-4-yl)aniline (PubChem CID 54975253) has the molecular formula C11H16N2O3S2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 5-methylsulfonyl-2-(1-oxo-1,4-thiazinan-4-yl)aniline.
| Compound Name | 5-methylsulfonyl-2-(1-oxo-1,4-thiazinan-4-yl)aniline |
|---|---|
| PubChem CID | 54975253 |
| Molecular Formula | C11H16N2O3S2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 5-methylsulfonyl-2-(1-oxo-1,4-thiazinan-4-yl)aniline |
| SMILES | CS(=O)(=O)c1ccc(N2CCS(=O)CC2)c(N)c1 |
| InChI | InChI=1S/C11H16N2O3S2/c1-18(15,16)9-2-3-11(10(12)8-9)13-4-6-17(14)7-5-13/h2-3,8H,4-7,12H2,1H3 |
| InChIKey | DAPOOHAVQSMEKL-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|