C14H23N3O2S — CID 43447932
5-methylsulfonyl-2-(4-propylpiperazin-1-yl)aniline (PubChem CID 43447932) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is 5-methylsulfonyl-2-(4-propylpiperazin-1-yl)aniline.
| Compound Name | 5-methylsulfonyl-2-(4-propylpiperazin-1-yl)aniline |
|---|---|
| PubChem CID | 43447932 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 5-methylsulfonyl-2-(4-propylpiperazin-1-yl)aniline |
| SMILES | CCCN1CCN(c2ccc(S(C)(=O)=O)cc2N)CC1 |
| InChI | InChI=1S/C14H23N3O2S/c1-3-6-16-7-9-17(10-8-16)14-5-4-12(11-13(14)15)20(2,18)19/h4-5,11H,3,6-10,15H2,1-2H3 |
| InChIKey | QKCOOXUZHOVUBH-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|