C14H21N3O4S — CID 21430463
4-(4-propylpiperazin-1-yl)-3-sulfamoylbenzoic acid (PubChem CID 21430463) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is 4-(4-propylpiperazin-1-yl)-3-sulfamoylbenzoic acid.
| Compound Name | 4-(4-propylpiperazin-1-yl)-3-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 21430463 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 4-(4-propylpiperazin-1-yl)-3-sulfamoylbenzoic acid |
| SMILES | CCCN1CCN(c2ccc(C(=O)O)cc2S(N)(=O)=O)CC1 |
| InChI | InChI=1S/C14H21N3O4S/c1-2-5-16-6-8-17(9-7-16)12-4-3-11(14(18)19)10-13(12)22(15,20)21/h3-4,10H,2,5-9H2,1H3,(H,18,19)(H2,15,20,21) |
| InChIKey | IZRMWTPXYNUJQD-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |