C15H21N3O4S — CID 21430444
4-(4-methylpiperazin-1-yl)-3-(prop-2-enylsulfamoyl)benzoic acid (PubChem CID 21430444) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)-3-(prop-2-enylsulfamoyl)benzoic acid.
| Compound Name | 4-(4-methylpiperazin-1-yl)-3-(prop-2-enylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 21430444 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)-3-(prop-2-enylsulfamoyl)benzoic acid |
| SMILES | C=CCNS(=O)(=O)c1cc(C(=O)O)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C15H21N3O4S/c1-3-6-16-23(21,22)14-11-12(15(19)20)4-5-13(14)18-9-7-17(2)8-10-18/h3-5,11,16H,1,6-10H2,2H3,(H,19,20) |
| InChIKey | CZVPOMCNQQHSDL-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|