C24H28N4O3S — CID 99967054
3-(ethylsulfamoyl)-4-(4-methylpiperazin-1-yl)-N-naphthalen-1-ylbenzamide (PubChem CID 99967054) has the molecular formula C24H28N4O3S and a molecular weight of 452.58 g/mol. Its IUPAC name is 3-(ethylsulfamoyl)-4-(4-methylpiperazin-1-yl)-N-naphthalen-1-ylbenzamide.
| Compound Name | 3-(ethylsulfamoyl)-4-(4-methylpiperazin-1-yl)-N-naphthalen-1-ylbenzamide |
|---|---|
| PubChem CID | 99967054 |
| Molecular Formula | C24H28N4O3S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 3-(ethylsulfamoyl)-4-(4-methylpiperazin-1-yl)-N-naphthalen-1-ylbenzamide |
| SMILES | CCNS(=O)(=O)c1cc(C(=O)Nc2cccc3ccccc23)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C24H28N4O3S/c1-3-25-32(30,31)23-17-19(11-12-22(23)28-15-13-27(2)14-16-28)24(29)26-21-10-6-8-18-7-4-5-9-20(18)21/h4-12,17,25H,3,13-16H2,1-2H3,(H,26,29) |
| InChIKey | GLSCSOUOOGYKJS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |