C19H25N5O5S2 — CID 99967016
4-(4-methylpiperazin-1-yl)-3-(methylsulfamoyl)-N-(4-sulfamoylphenyl)benzamide (PubChem CID 99967016) has the molecular formula C19H25N5O5S2 and a molecular weight of 467.57 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)-3-(methylsulfamoyl)-N-(4-sulfamoylphenyl)benzamide.
| Compound Name | 4-(4-methylpiperazin-1-yl)-3-(methylsulfamoyl)-N-(4-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 99967016 |
| Molecular Formula | C19H25N5O5S2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)-3-(methylsulfamoyl)-N-(4-sulfamoylphenyl)benzamide |
| SMILES | CNS(=O)(=O)c1cc(C(=O)Nc2ccc(S(N)(=O)=O)cc2)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C19H25N5O5S2/c1-21-31(28,29)18-13-14(3-8-17(18)24-11-9-23(2)10-12-24)19(25)22-15-4-6-16(7-5-15)30(20,26)27/h3-8,13,21H,9-12H2,1-2H3,(H,22,25)(H2,20,26,27) |
| InChIKey | SJMGYHXPLDGCJN-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |