C19H23IN4O3S — CID 99966997
N-(4-iodophenyl)-4-(4-methylpiperazin-1-yl)-3-(methylsulfamoyl)benzamide (PubChem CID 99966997) has the molecular formula C19H23IN4O3S and a molecular weight of 514.39 g/mol. Its IUPAC name is N-(4-iodophenyl)-4-(4-methylpiperazin-1-yl)-3-(methylsulfamoyl)benzamide.
| Compound Name | N-(4-iodophenyl)-4-(4-methylpiperazin-1-yl)-3-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 99966997 |
| Molecular Formula | C19H23IN4O3S |
| Molecular Weight | 514.39 g/mol |
| Exact Mass | 514.05 |
| IUPAC Name | N-(4-iodophenyl)-4-(4-methylpiperazin-1-yl)-3-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1cc(C(=O)Nc2ccc(I)cc2)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C19H23IN4O3S/c1-21-28(26,27)18-13-14(19(25)22-16-6-4-15(20)5-7-16)3-8-17(18)24-11-9-23(2)10-12-24/h3-8,13,21H,9-12H2,1-2H3,(H,22,25) |
| InChIKey | TVRQBSYOWJPXLL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|