C24H26N4O3S — CID 53279951
4-(benzenesulfonamido)-N-[4-(4-methylpiperazin-1-yl)phenyl]benzamide (PubChem CID 53279951) has the molecular formula C24H26N4O3S and a molecular weight of 450.56 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-N-[4-(4-methylpiperazin-1-yl)phenyl]benzamide.
| Compound Name | 4-(benzenesulfonamido)-N-[4-(4-methylpiperazin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 53279951 |
| Molecular Formula | C24H26N4O3S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 4-(benzenesulfonamido)-N-[4-(4-methylpiperazin-1-yl)phenyl]benzamide |
| SMILES | CN1CCN(c2ccc(NC(=O)c3ccc(NS(=O)(=O)c4ccccc4)cc3)cc2)CC1 |
| InChI | InChI=1S/C24H26N4O3S/c1-27-15-17-28(18-16-27)22-13-11-20(12-14-22)25-24(29)19-7-9-21(10-8-19)26-32(30,31)23-5-3-2-4-6-23/h2-14,26H,15-18H2,1H3,(H,25,29) |
| InChIKey | CAHNXEPSJMSRFC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|