C29H34N4O — CID 144638395
4-(4-methylpiperazin-1-yl)-N-[4-[(3R)-5-phenylpiperidin-3-yl]phenyl]benzamide (PubChem CID 144638395) has the molecular formula C29H34N4O and a molecular weight of 454.62 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)-N-[4-[(3R)-5-phenylpiperidin-3-yl]phenyl]benzamide.
| Compound Name | 4-(4-methylpiperazin-1-yl)-N-[4-[(3R)-5-phenylpiperidin-3-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 144638395 |
| Molecular Formula | C29H34N4O |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)-N-[4-[(3R)-5-phenylpiperidin-3-yl]phenyl]benzamide |
| SMILES | CN1CCN(c2ccc(C(=O)Nc3ccc([C@@H]4CNCC(c5ccccc5)C4)cc3)cc2)CC1 |
| InChI | InChI=1S/C29H34N4O/c1-32-15-17-33(18-16-32)28-13-9-24(10-14-28)29(34)31-27-11-7-23(8-12-27)26-19-25(20-30-21-26)22-5-3-2-4-6-22/h2-14,25-26,30H,15-21H2,1H3,(H,31,34)/t25?,26-/m0/s1 |
| InChIKey | IYGOEIPNJFQDPF-AMVUTOCUSA-N |
| XLogP | 4.55 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |