C28H30N2O — CID 144638426
4-(1-methylpiperidin-4-yl)-N-[4-[(1R,2S)-2-phenylcyclopropyl]phenyl]benzamide (PubChem CID 144638426) has the molecular formula C28H30N2O and a molecular weight of 410.56 g/mol. Its IUPAC name is 4-(1-methylpiperidin-4-yl)-N-[4-[(1R,2S)-2-phenylcyclopropyl]phenyl]benzamide.
| Compound Name | 4-(1-methylpiperidin-4-yl)-N-[4-[(1R,2S)-2-phenylcyclopropyl]phenyl]benzamide |
|---|---|
| PubChem CID | 144638426 |
| Molecular Formula | C28H30N2O |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | 4-(1-methylpiperidin-4-yl)-N-[4-[(1R,2S)-2-phenylcyclopropyl]phenyl]benzamide |
| SMILES | CN1CCC(c2ccc(C(=O)Nc3ccc([C@@H]4C[C@@H]4c4ccccc4)cc3)cc2)CC1 |
| InChI | InChI=1S/C28H30N2O/c1-30-17-15-21(16-18-30)20-7-9-24(10-8-20)28(31)29-25-13-11-23(12-14-25)27-19-26(27)22-5-3-2-4-6-22/h2-14,21,26-27H,15-19H2,1H3,(H,29,31)/t26-,27+/m1/s1 |
| InChIKey | RGMCMGXYUMXWNT-SXOMAYOGSA-N |
| XLogP | 6.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |