C16H21NO2 — CID 116988137
2-[4-(1-methylpiperidin-4-yl)phenyl]cyclopropane-1-carboxylic acid (PubChem CID 116988137) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is 2-[4-(1-methylpiperidin-4-yl)phenyl]cyclopropane-1-carboxylic acid.
| Compound Name | 2-[4-(1-methylpiperidin-4-yl)phenyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 116988137 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 2-[4-(1-methylpiperidin-4-yl)phenyl]cyclopropane-1-carboxylic acid |
| SMILES | CN1CCC(c2ccc(C3CC3C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C16H21NO2/c1-17-8-6-12(7-9-17)11-2-4-13(5-3-11)14-10-15(14)16(18)19/h2-5,12,14-15H,6-10H2,1H3,(H,18,19) |
| InChIKey | MYMRQPKKPYXSJL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |