C19H16N2O5S — CID 59762981
methyl 6-[(4-sulfamoylphenyl)carbamoyl]naphthalene-2-carboxylate (PubChem CID 59762981) has the molecular formula C19H16N2O5S and a molecular weight of 384.41 g/mol. Its IUPAC name is methyl 6-[(4-sulfamoylphenyl)carbamoyl]naphthalene-2-carboxylate.
| Compound Name | methyl 6-[(4-sulfamoylphenyl)carbamoyl]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 59762981 |
| Molecular Formula | C19H16N2O5S |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | methyl 6-[(4-sulfamoylphenyl)carbamoyl]naphthalene-2-carboxylate |
| SMILES | COC(=O)c1ccc2cc(C(=O)Nc3ccc(S(N)(=O)=O)cc3)ccc2c1 |
| InChI | InChI=1S/C19H16N2O5S/c1-26-19(23)15-5-3-12-10-14(4-2-13(12)11-15)18(22)21-16-6-8-17(9-7-16)27(20,24)25/h2-11H,1H3,(H,21,22)(H2,20,24,25) |
| InChIKey | PQSBJGDPJKGBTP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |