C14H13NO4S — CID 122194771
methyl 4-(4-sulfamoylphenyl)benzoate (PubChem CID 122194771) has the molecular formula C14H13NO4S and a molecular weight of 291.33 g/mol. Its IUPAC name is methyl 4-(4-sulfamoylphenyl)benzoate.
| Compound Name | methyl 4-(4-sulfamoylphenyl)benzoate |
|---|---|
| PubChem CID | 122194771 |
| Molecular Formula | C14H13NO4S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | methyl 4-(4-sulfamoylphenyl)benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C14H13NO4S/c1-19-14(16)12-4-2-10(3-5-12)11-6-8-13(9-7-11)20(15,17)18/h2-9H,1H3,(H2,15,17,18) |
| InChIKey | LDVISLLDEAZEMG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |