C24H22N4O9S4 — CID 174843361
4-[4-[[[4-(4-sulfamoylphenyl)phenyl]sulfonylamino]oxysulfamoyl]phenyl]benzenesulfonamide (PubChem CID 174843361) has the molecular formula C24H22N4O9S4 and a molecular weight of 638.73 g/mol. Its IUPAC name is 4-[4-[[[4-(4-sulfamoylphenyl)phenyl]sulfonylamino]oxysulfamoyl]phenyl]benzenesulfonamide.
| Compound Name | 4-[4-[[[4-(4-sulfamoylphenyl)phenyl]sulfonylamino]oxysulfamoyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 174843361 |
| Molecular Formula | C24H22N4O9S4 |
| Molecular Weight | 638.73 g/mol |
| Exact Mass | 638.03 |
| IUPAC Name | 4-[4-[[[4-(4-sulfamoylphenyl)phenyl]sulfonylamino]oxysulfamoyl]phenyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-c2ccc(S(=O)(=O)NONS(=O)(=O)c3ccc(-c4ccc(S(N)(=O)=O)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H22N4O9S4/c25-38(29,30)21-9-1-17(2-10-21)19-5-13-23(14-6-19)40(33,34)27-37-28-41(35,36)24-15-7-20(8-16-24)18-3-11-22(12-4-18)39(26,31)32/h1-16,27-28H,(H2,25,29,30)(H2,26,31,32) |
| InChIKey | UQAFVBYGGRQENS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 221.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.73 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|