C8H14N4O3S — CID 174801132
aminourea;4-methylbenzenesulfonamide (PubChem CID 174801132) has the molecular formula C8H14N4O3S and a molecular weight of 246.29 g/mol. Its IUPAC name is aminourea;4-methylbenzenesulfonamide.
| Compound Name | aminourea;4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 174801132 |
| Molecular Formula | C8H14N4O3S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | aminourea;4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1.NNC(N)=O |
| InChI | InChI=1S/C7H9NO2S.CH5N3O/c1-6-2-4-7(5-3-6)11(8,9)10;2-1(5)4-3/h2-5H,1H3,(H2,8,9,10);3H2,(H3,2,4,5) |
| InChIKey | ABYFWMYTGBHSRJ-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 141.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|