C6H7FN2O4S2 — CID 175065506
4-N-fluorobenzene-1,4-disulfonamide (PubChem CID 175065506) has the molecular formula C6H7FN2O4S2 and a molecular weight of 254.26 g/mol. Its IUPAC name is 4-N-fluorobenzene-1,4-disulfonamide.
| Compound Name | 4-N-fluorobenzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 175065506 |
| Molecular Formula | C6H7FN2O4S2 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 253.98 |
| IUPAC Name | 4-N-fluorobenzene-1,4-disulfonamide |
| SMILES | NS(=O)(=O)c1ccc(S(=O)(=O)NF)cc1 |
| InChI | InChI=1S/C6H7FN2O4S2/c7-9-15(12,13)6-3-1-5(2-4-6)14(8,10)11/h1-4,9H,(H2,8,10,11) |
| InChIKey | VCSDUXYASIFBJY-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|