About 4-aminobenzenesulfonamide;fluoroform
4-aminobenzenesulfonamide;fluoroform (PubChem CID 121362415) has the molecular formula C7H9F3N2O2S
and a molecular weight of 242.22 g/mol. Its IUPAC name is 4-aminobenzenesulfonamide;fluoroform.
Molecular Properties
| Compound Name | 4-aminobenzenesulfonamide;fluoroform |
| PubChem CID | 121362415 |
| Molecular Formula | C7H9F3N2O2S |
| Molecular Weight | 242.22 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 4-aminobenzenesulfonamide;fluoroform |
| SMILES | FC(F)F.Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C6H8N2O2S.CHF3/c7-5-1-3-6(4-2-5)11(8,9)10;2-1(3)4/h1-4H,7H2,(H2,8,9,10);1H |
| InChIKey | XCSCKTOCMOZNFZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.22 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-aminobenzenesulfonamide;fluoroform with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminobenzenesulfonamide;fluoroform?
The IUPAC name of 4-aminobenzenesulfonamide;fluoroform (CID 121362415) is 4-aminobenzenesulfonamide;fluoroform.
What is the SMILES notation for 4-aminobenzenesulfonamide;fluoroform?
The canonical SMILES for 4-aminobenzenesulfonamide;fluoroform is FC(F)F.Nc1ccc(S(N)(=O)=O)cc1.
What is the InChIKey of 4-aminobenzenesulfonamide;fluoroform?
The InChIKey is XCSCKTOCMOZNFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S.CHF3/c7-5-1-3-6(4-2-5)11(8,9)10;2-1(3)4/h1-4H,7H2,(H2,8,9,10);1H.
What are the key properties of 4-aminobenzenesulfonamide;fluoroform?
4-aminobenzenesulfonamide;fluoroform has a molecular weight of 242.22 g/mol, XLogP of 1.09, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminobenzenesulfonamide;fluoroform is sourced from PubChem (CID 121362415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).